C22H18F4N4O4 — CID 20824268
4-N,6-N-bis[[4-(difluoromethoxy)phenyl]methyl]pyrimidine-4,6-dicarboxamide (PubChem CID 20824268) has the molecular formula C22H18F4N4O4 and a molecular weight of 478.40 g/mol. Its IUPAC name is 4-N,6-N-bis[[4-(difluoromethoxy)phenyl]methyl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N,6-N-bis[[4-(difluoromethoxy)phenyl]methyl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 20824268 |
| Molecular Formula | C22H18F4N4O4 |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 4-N,6-N-bis[[4-(difluoromethoxy)phenyl]methyl]pyrimidine-4,6-dicarboxamide |
| SMILES | O=C(NCc1ccc(OC(F)F)cc1)c1cc(C(=O)NCc2ccc(OC(F)F)cc2)ncn1 |
| InChI | InChI=1S/C22H18F4N4O4/c23-21(24)33-15-5-1-13(2-6-15)10-27-19(31)17-9-18(30-12-29-17)20(32)28-11-14-3-7-16(8-4-14)34-22(25)26/h1-9,12,21-22H,10-11H2,(H,27,31)(H,28,32) |
| InChIKey | JQDPSBSYQRGHSR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |