C11H13N2OP — CID 20824336
1-(8-phosphanyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)prop-2-yn-1-ol (PubChem CID 20824336) has the molecular formula C11H13N2OP and a molecular weight of 220.21 g/mol. Its IUPAC name is 1-(8-phosphanyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)prop-2-yn-1-ol.
| Compound Name | 1-(8-phosphanyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 20824336 |
| Molecular Formula | C11H13N2OP |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-(8-phosphanyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)prop-2-yn-1-ol |
| SMILES | C#CC(O)c1ccc2c(n1)N(P)CCC2 |
| InChI | InChI=1S/C11H13N2OP/c1-2-10(14)9-6-5-8-4-3-7-13(15)11(8)12-9/h1,5-6,10,14H,3-4,7,15H2 |
| InChIKey | PFZZDAYEOCALES-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|