About 3-methylthieno[3,2-f][1]benzothiole
3-methylthieno[3,2-f][1]benzothiole (PubChem CID 20824629) has the molecular formula C11H8S2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 3-methylthieno[3,2-f][1]benzothiole.
Molecular Properties
| Compound Name | 3-methylthieno[3,2-f][1]benzothiole |
| PubChem CID | 20824629 |
| Molecular Formula | C11H8S2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 3-methylthieno[3,2-f][1]benzothiole |
| SMILES | Cc1csc2cc3sccc3cc12 |
| InChI | InChI=1S/C11H8S2/c1-7-6-13-11-5-10-8(2-3-12-10)4-9(7)11/h2-6H,1H3 |
| InChIKey | QSXLLAXYVQQXCS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylthieno[3,2-f][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylthieno[3,2-f][1]benzothiole?
The IUPAC name of 3-methylthieno[3,2-f][1]benzothiole (CID 20824629) is 3-methylthieno[3,2-f][1]benzothiole.
What is the SMILES notation for 3-methylthieno[3,2-f][1]benzothiole?
The canonical SMILES for 3-methylthieno[3,2-f][1]benzothiole is Cc1csc2cc3sccc3cc12.
What is the InChIKey of 3-methylthieno[3,2-f][1]benzothiole?
The InChIKey is QSXLLAXYVQQXCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8S2/c1-7-6-13-11-5-10-8(2-3-12-10)4-9(7)11/h2-6H,1H3.
What are the key properties of 3-methylthieno[3,2-f][1]benzothiole?
3-methylthieno[3,2-f][1]benzothiole has a molecular weight of 204.32 g/mol, XLogP of 4.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylthieno[3,2-f][1]benzothiole is sourced from PubChem (CID 20824629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).