C13H18N2O — CID 20824946
[(4R,10aR)-4-methyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indol-7-yl]methanol (PubChem CID 20824946) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is [(4R,10aR)-4-methyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indol-7-yl]methanol.
| Compound Name | [(4R,10aR)-4-methyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indol-7-yl]methanol |
|---|---|
| PubChem CID | 20824946 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | [(4R,10aR)-4-methyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indol-7-yl]methanol |
| SMILES | C[C@@H]1CNC[C@H]2Cc3ccc(CO)cc3N21 |
| InChI | InChI=1S/C13H18N2O/c1-9-6-14-7-12-5-11-3-2-10(8-16)4-13(11)15(9)12/h2-4,9,12,14,16H,5-8H2,1H3/t9-,12-/m1/s1 |
| InChIKey | PLKQFDHSUAGPKA-BXKDBHETSA-N |
| XLogP | 0.90 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |