C11H12N2 — CID 20824956
9a,10,10a-trideuterio-9,10-dihydropyrazino[1,2-a]indole (PubChem CID 20824956) has the molecular formula C11H12N2 and a molecular weight of 175.25 g/mol. Its IUPAC name is 9a,10,10a-trideuterio-9,10-dihydropyrazino[1,2-a]indole.
| Compound Name | 9a,10,10a-trideuterio-9,10-dihydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 20824956 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 9a,10,10a-trideuterio-9,10-dihydropyrazino[1,2-a]indole |
| SMILES | [2H]C1C2([2H])CC=CC=C2N2C=CN=CC12[2H] |
| InChI | InChI=1S/C11H12N2/c1-2-4-11-9(3-1)7-10-8-12-5-6-13(10)11/h1-2,4-6,8-10H,3,7H2/i7D,9D,10D |
| InChIKey | MFAZXQFBIHWWMD-WUVVEJKKSA-N |
| XLogP | 2.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |