About N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide
N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide (PubChem CID 2082544) has the molecular formula C10H13Cl2N3O2
and a molecular weight of 278.14 g/mol. Its IUPAC name is N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide |
| PubChem CID | 2082544 |
| Molecular Formula | C10H13Cl2N3O2 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide |
| SMILES | CCCCNC(=O)Cn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C10H13Cl2N3O2/c1-2-3-4-13-8(16)6-15-10(17)9(12)7(11)5-14-15/h5H,2-4,6H2,1H3,(H,13,16) |
| InChIKey | LRUAONGUZQWNRM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide?
The IUPAC name of N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide (CID 2082544) is N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide.
What is the SMILES notation for N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide?
The canonical SMILES for N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide is CCCCNC(=O)Cn1ncc(Cl)c(Cl)c1=O.
What is the InChIKey of N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide?
The InChIKey is LRUAONGUZQWNRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl2N3O2/c1-2-3-4-13-8(16)6-15-10(17)9(12)7(11)5-14-15/h5H,2-4,6H2,1H3,(H,13,16).
What are the key properties of N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide?
N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide has a molecular weight of 278.14 g/mol, XLogP of 1.47, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide is sourced from PubChem (CID 2082544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).