About 2-(tert-butylamino)-4,4-dimethylpentanenitrile
2-(tert-butylamino)-4,4-dimethylpentanenitrile (PubChem CID 20825455) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-(tert-butylamino)-4,4-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 2-(tert-butylamino)-4,4-dimethylpentanenitrile |
| PubChem CID | 20825455 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2-(tert-butylamino)-4,4-dimethylpentanenitrile |
| SMILES | CC(C)(C)CC(C#N)NC(C)(C)C |
| InChI | InChI=1S/C11H22N2/c1-10(2,3)7-9(8-12)13-11(4,5)6/h9,13H,7H2,1-6H3 |
| InChIKey | JYMHKGIHVROCDT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(tert-butylamino)-4,4-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butylamino)-4,4-dimethylpentanenitrile?
The IUPAC name of 2-(tert-butylamino)-4,4-dimethylpentanenitrile (CID 20825455) is 2-(tert-butylamino)-4,4-dimethylpentanenitrile.
What is the SMILES notation for 2-(tert-butylamino)-4,4-dimethylpentanenitrile?
The canonical SMILES for 2-(tert-butylamino)-4,4-dimethylpentanenitrile is CC(C)(C)CC(C#N)NC(C)(C)C.
What is the InChIKey of 2-(tert-butylamino)-4,4-dimethylpentanenitrile?
The InChIKey is JYMHKGIHVROCDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-10(2,3)7-9(8-12)13-11(4,5)6/h9,13H,7H2,1-6H3.
What are the key properties of 2-(tert-butylamino)-4,4-dimethylpentanenitrile?
2-(tert-butylamino)-4,4-dimethylpentanenitrile has a molecular weight of 182.31 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butylamino)-4,4-dimethylpentanenitrile is sourced from PubChem (CID 20825455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).