C12H24N2 — CID 20825473
2-(tert-butylamino)-5,5-dimethylhexanenitrile (PubChem CID 20825473) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 2-(tert-butylamino)-5,5-dimethylhexanenitrile.
| Compound Name | 2-(tert-butylamino)-5,5-dimethylhexanenitrile |
|---|---|
| PubChem CID | 20825473 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 2-(tert-butylamino)-5,5-dimethylhexanenitrile |
| SMILES | CC(C)(C)CCC(C#N)NC(C)(C)C |
| InChI | InChI=1S/C12H24N2/c1-11(2,3)8-7-10(9-13)14-12(4,5)6/h10,14H,7-8H2,1-6H3 |
| InChIKey | MOCHPFYQHIDAPQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |