C13H20N2 — CID 20825700
1-(2-methanidyl-1,2,3,4-tetrahydroisoquinolin-2-ium-5-yl)-N,N-dimethylmethanamine (PubChem CID 20825700) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-(2-methanidyl-1,2,3,4-tetrahydroisoquinolin-2-ium-5-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(2-methanidyl-1,2,3,4-tetrahydroisoquinolin-2-ium-5-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 20825700 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-(2-methanidyl-1,2,3,4-tetrahydroisoquinolin-2-ium-5-yl)-N,N-dimethylmethanamine |
| SMILES | [CH2-][NH+]1CCc2c(CN(C)C)cccc2C1 |
| InChI | InChI=1S/C13H20N2/c1-14(2)9-11-5-4-6-12-10-15(3)8-7-13(11)12/h4-6,15H,3,7-10H2,1-2H3 |
| InChIKey | FLTIUNRQJJNYCN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|