C6H9N3 — CID 20825705
5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine (PubChem CID 20825705) has the molecular formula C6H9N3 and a molecular weight of 123.16 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine.
| Compound Name | 5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 20825705 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine |
| SMILES | c1ncn2c1CNCC2 |
| InChI | InChI=1S/C6H9N3/c1-2-9-5-8-4-6(9)3-7-1/h4-5,7H,1-3H2 |
| InChIKey | WROMFHICINADER-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |