About 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine
2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine (PubChem CID 20825717) has the molecular formula C15H20N3-
and a molecular weight of 242.35 g/mol. Its IUPAC name is 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine.
Molecular Properties
| Compound Name | 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine |
| PubChem CID | 20825717 |
| Molecular Formula | C15H20N3- |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine |
| SMILES | [CH2-]N1CCc2nc(CN3CC4CC4C3)ccc2C1 |
| InChI | InChI=1S/C15H20N3/c1-17-5-4-15-11(7-17)2-3-14(16-15)10-18-8-12-6-13(12)9-18/h2-3,12-13H,1,4-10H2/q-1 |
| InChIKey | OZFFKRJOABRJDY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine?
The IUPAC name of 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine (CID 20825717) is 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine.
What is the SMILES notation for 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine?
The canonical SMILES for 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine is [CH2-]N1CCc2nc(CN3CC4CC4C3)ccc2C1.
What is the InChIKey of 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine?
The InChIKey is OZFFKRJOABRJDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N3/c1-17-5-4-15-11(7-17)2-3-14(16-15)10-18-8-12-6-13(12)9-18/h2-3,12-13H,1,4-10H2/q-1.
What are the key properties of 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine?
2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine has a molecular weight of 242.35 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-6-methanidyl-7,8-dihydro-5H-1,6-naphthyridine is sourced from PubChem (CID 20825717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).