C13H22N4O — CID 20825780
7-methanidyl-3-(4-methoxypiperidin-1-yl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-7-ium (PubChem CID 20825780) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 7-methanidyl-3-(4-methoxypiperidin-1-yl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-7-ium.
| Compound Name | 7-methanidyl-3-(4-methoxypiperidin-1-yl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-7-ium |
|---|---|
| PubChem CID | 20825780 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 7-methanidyl-3-(4-methoxypiperidin-1-yl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-7-ium |
| SMILES | [CH2-][NH+]1CCn2c(cnc2N2CCC(OC)CC2)C1 |
| InChI | InChI=1S/C13H22N4O/c1-15-7-8-17-11(10-15)9-14-13(17)16-5-3-12(18-2)4-6-16/h9,12,15H,1,3-8,10H2,2H3 |
| InChIKey | MXHCCUXMQFNFSY-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 34.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|