About 3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine
3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine (PubChem CID 20825880) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine.
Analyze 3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine?
The IUPAC name of 3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine (CID 20825880) is 3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine.
What is the SMILES notation for 3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine?
The canonical SMILES for 3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine is Cc1ncc2n1CCNC2.
What is the InChIKey of 3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine?
The InChIKey is GMMYNKQIGMWPCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-6-9-5-7-4-8-2-3-10(6)7/h5,8H,2-4H2,1H3.
What are the key properties of 3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine?
3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine has a molecular weight of 137.19 g/mol, XLogP of 0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine is sourced from PubChem (CID 20825880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).