About 5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine
5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine (PubChem CID 20826016) has the molecular formula C13H12ClN
and a molecular weight of 217.70 g/mol. Its IUPAC name is 5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine.
Molecular Properties
| Compound Name | 5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine |
| PubChem CID | 20826016 |
| Molecular Formula | C13H12ClN |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine |
| SMILES | Clc1cc(-c2ccccc2)c2n1CCC2 |
| InChI | InChI=1S/C13H12ClN/c14-13-9-11(10-5-2-1-3-6-10)12-7-4-8-15(12)13/h1-3,5-6,9H,4,7-8H2 |
| InChIKey | UGWDMEONIOXRQT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine?
The IUPAC name of 5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine (CID 20826016) is 5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine.
What is the SMILES notation for 5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine?
The canonical SMILES for 5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine is Clc1cc(-c2ccccc2)c2n1CCC2.
What is the InChIKey of 5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine?
The InChIKey is UGWDMEONIOXRQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN/c14-13-9-11(10-5-2-1-3-6-10)12-7-4-8-15(12)13/h1-3,5-6,9H,4,7-8H2.
What are the key properties of 5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine?
5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine has a molecular weight of 217.70 g/mol, XLogP of 3.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-7-phenyl-2,3-dihydro-1H-pyrrolizine is sourced from PubChem (CID 20826016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).