About 7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane
7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane (PubChem CID 20826082) has the molecular formula C21H44O3
and a molecular weight of 344.58 g/mol. Its IUPAC name is 7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane.
Molecular Properties
| Compound Name | 7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane |
| PubChem CID | 20826082 |
| Molecular Formula | C21H44O3 |
| Molecular Weight | 344.58 g/mol |
| Exact Mass | 344.33 |
| IUPAC Name | 7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane |
| SMILES | CCCOCC(CCCCC(C)CC)(COCCC)COCCC |
| InChI | InChI=1S/C21H44O3/c1-6-14-22-17-21(18-23-15-7-2,19-24-16-8-3)13-11-10-12-20(5)9-4/h20H,6-19H2,1-5H3 |
| InChIKey | SWHCWGRLDVGMKT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane?
The IUPAC name of 7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane (CID 20826082) is 7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane.
What is the SMILES notation for 7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane?
The canonical SMILES for 7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane is CCCOCC(CCCCC(C)CC)(COCCC)COCCC.
What is the InChIKey of 7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane?
The InChIKey is SWHCWGRLDVGMKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44O3/c1-6-14-22-17-21(18-23-15-7-2,19-24-16-8-3)13-11-10-12-20(5)9-4/h20H,6-19H2,1-5H3.
What are the key properties of 7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane?
7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane has a molecular weight of 344.58 g/mol, XLogP of 5.86, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1-propoxy-2,2-bis(propoxymethyl)nonane is sourced from PubChem (CID 20826082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).