About 5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene
5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene (PubChem CID 20826215) has the molecular formula C11H12S
and a molecular weight of 176.28 g/mol. Its IUPAC name is 5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene.
Molecular Properties
| Compound Name | 5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene |
| PubChem CID | 20826215 |
| Molecular Formula | C11H12S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene |
| SMILES | C#Cc1cc(C)c(C)c(SC)c1 |
| InChI | InChI=1S/C11H12S/c1-5-10-6-8(2)9(3)11(7-10)12-4/h1,6-7H,2-4H3 |
| InChIKey | VAZCGPUXRGMUHL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene?
The IUPAC name of 5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene (CID 20826215) is 5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene.
What is the SMILES notation for 5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene?
The canonical SMILES for 5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene is C#Cc1cc(C)c(C)c(SC)c1.
What is the InChIKey of 5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene?
The InChIKey is VAZCGPUXRGMUHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12S/c1-5-10-6-8(2)9(3)11(7-10)12-4/h1,6-7H,2-4H3.
What are the key properties of 5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene?
5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene has a molecular weight of 176.28 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-1,2-dimethyl-3-methylsulfanylbenzene is sourced from PubChem (CID 20826215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).