C40H40N10O3S2 — CID 20826280
2-[3-tert-butyl-4-cyano-5-[[5-cyano-4-methyl-2,6-bis(2,4,6-trimethylanilino)-3-pyridinyl]diazenyl]pyrazol-1-yl]-1,3-benzothiazole-6-sulfonic acid (PubChem CID 20826280) has the molecular formula C40H40N10O3S2 and a molecular weight of 772.96 g/mol. Its IUPAC name is 2-[3-tert-butyl-4-cyano-5-[[5-cyano-4-methyl-2,6-bis(2,4,6-trimethylanilino)-3-pyridinyl]diazenyl]pyrazol-1-yl]-1,3-benzothiazole-6-sulfonic acid.
| Compound Name | 2-[3-tert-butyl-4-cyano-5-[[5-cyano-4-methyl-2,6-bis(2,4,6-trimethylanilino)-3-pyridinyl]diazenyl]pyrazol-1-yl]-1,3-benzothiazole-6-sulfonic acid |
|---|---|
| PubChem CID | 20826280 |
| Molecular Formula | C40H40N10O3S2 |
| Molecular Weight | 772.96 g/mol |
| Exact Mass | 772.27 |
| IUPAC Name | 2-[3-tert-butyl-4-cyano-5-[[5-cyano-4-methyl-2,6-bis(2,4,6-trimethylanilino)-3-pyridinyl]diazenyl]pyrazol-1-yl]-1,3-benzothiazole-6-sulfonic acid |
| SMILES | Cc1cc(C)c(Nc2nc(Nc3c(C)cc(C)cc3C)c(/N=N/c3c(C#N)c(C(C)(C)C)nn3-c3nc4ccc(S(=O)(=O)O)cc4s3)c(C)c2C#N)c(C)c1 |
| InChI | InChI=1S/C40H40N10O3S2/c1-20-13-22(3)32(23(4)14-20)44-36-28(18-41)26(7)34(37(46-36)45-33-24(5)15-21(2)16-25(33)6)47-48-38-29(19-42)35(40(8,9)10)49-50(38)39-43-30-12-11-27(55(51,52)53)17-31(30)54-39/h11-17H,1-10H3,(H2,44,45,46)(H,51,52,53)/b48-47+ |
| InChIKey | GUCKCXUTIGYWDT-QJGAVIKSSA-N |
| XLogP | 10.23 |
| TPSA | 194.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.96 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|