C19H23F9O3 — CID 20826503
[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-adamantyl] 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 20826503) has the molecular formula C19H23F9O3 and a molecular weight of 470.37 g/mol. Its IUPAC name is [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-adamantyl] 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-adamantyl] 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 20826503 |
| Molecular Formula | C19H23F9O3 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-adamantyl] 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC12CC3CC(C1)CC(C(O)(C(F)(F)F)C(F)(F)F)(C3)C2)C(F)(F)F |
| InChI | InChI=1S/C19H23F9O3/c1-3-13(2,17(20,21)22)12(29)31-15-7-10-4-11(8-15)6-14(5-10,9-15)16(30,18(23,24)25)19(26,27)28/h10-11,30H,3-9H2,1-2H3 |
| InChIKey | LYGOCOOBTNBYCU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |