C19H26F6O3 — CID 20826516
[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 20826516) has the molecular formula C19H26F6O3 and a molecular weight of 416.40 g/mol. Its IUPAC name is [4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 20826516 |
| Molecular Formula | C19H26F6O3 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | [4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C2CC(C(=O)OC3CCC(C(O)(C(F)(F)F)C(F)(F)F)CC3)C(C2)C1C |
| InChI | InChI=1S/C19H26F6O3/c1-9-10(2)14-7-11(9)8-15(14)16(26)28-13-5-3-12(4-6-13)17(27,18(20,21)22)19(23,24)25/h9-15,27H,3-8H2,1-2H3 |
| InChIKey | PTRJNQYUIVSWOQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |