C20H27F9O5 — CID 20826522
[4-[1,1,1,3,3,3-hexafluoro-2-[(2-methylpropan-2-yl)oxycarbonyloxy]propan-2-yl]cyclohexyl] 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 20826522) has the molecular formula C20H27F9O5 and a molecular weight of 518.41 g/mol. Its IUPAC name is [4-[1,1,1,3,3,3-hexafluoro-2-[(2-methylpropan-2-yl)oxycarbonyloxy]propan-2-yl]cyclohexyl] 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | [4-[1,1,1,3,3,3-hexafluoro-2-[(2-methylpropan-2-yl)oxycarbonyloxy]propan-2-yl]cyclohexyl] 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 20826522 |
| Molecular Formula | C20H27F9O5 |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | [4-[1,1,1,3,3,3-hexafluoro-2-[(2-methylpropan-2-yl)oxycarbonyloxy]propan-2-yl]cyclohexyl] 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC1CCC(C(OC(=O)OC(C)(C)C)(C(F)(F)F)C(F)(F)F)CC1)C(F)(F)F |
| InChI | InChI=1S/C20H27F9O5/c1-6-16(5,18(21,22)23)13(30)32-12-9-7-11(8-10-12)17(19(24,25)26,20(27,28)29)34-14(31)33-15(2,3)4/h11-12H,6-10H2,1-5H3 |
| InChIKey | YMTXYEDVIVZWQU-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |