About [4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate
[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate (PubChem CID 20826527) has the molecular formula C15H22F6O3
and a molecular weight of 364.33 g/mol. Its IUPAC name is [4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate.
Molecular Properties
| Compound Name | [4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate |
| PubChem CID | 20826527 |
| Molecular Formula | C15H22F6O3 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CCC(CC(O)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H22F6O3/c1-3-9(2)12(22)24-11-6-4-10(5-7-11)8-13(23,14(16,17)18)15(19,20)21/h9-11,23H,3-8H2,1-2H3 |
| InChIKey | CPGDOUBBSDCNFG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate?
The IUPAC name of [4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate (CID 20826527) is [4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate.
What is the SMILES notation for [4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate?
The canonical SMILES for [4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate is CCC(C)C(=O)OC1CCC(CC(O)(C(F)(F)F)C(F)(F)F)CC1.
What is the InChIKey of [4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate?
The InChIKey is CPGDOUBBSDCNFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22F6O3/c1-3-9(2)12(22)24-11-6-4-10(5-7-11)8-13(23,14(16,17)18)15(19,20)21/h9-11,23H,3-8H2,1-2H3.
What are the key properties of [4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate?
[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate has a molecular weight of 364.33 g/mol, XLogP of 4.38, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylbutanoate is sourced from PubChem (CID 20826527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).