About tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate
tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate (PubChem CID 20826544) has the molecular formula C13H17F3O3
and a molecular weight of 278.27 g/mol. Its IUPAC name is tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate |
| PubChem CID | 20826544 |
| Molecular Formula | C13H17F3O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C(F)(F)F)CC2CC1C1OC21 |
| InChI | InChI=1S/C13H17F3O3/c1-11(2,3)19-10(17)12(13(14,15)16)5-6-4-7(12)9-8(6)18-9/h6-9H,4-5H2,1-3H3 |
| InChIKey | OCYUHQLVHIAUFP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate?
The IUPAC name of tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate (CID 20826544) is tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate.
What is the SMILES notation for tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate?
The canonical SMILES for tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate is CC(C)(C)OC(=O)C1(C(F)(F)F)CC2CC1C1OC21.
What is the InChIKey of tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate?
The InChIKey is OCYUHQLVHIAUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3O3/c1-11(2,3)19-10(17)12(13(14,15)16)5-6-4-7(12)9-8(6)18-9/h6-9H,4-5H2,1-3H3.
What are the key properties of tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate?
tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate has a molecular weight of 278.27 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-(trifluoromethyl)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate is sourced from PubChem (CID 20826544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).