About 2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate
2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 20826551) has the molecular formula C16H19F3O2
and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| PubChem CID | 20826551 |
| Molecular Formula | C16H19F3O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OC1CC2CCC1C2)C1(C(F)(F)F)CC2C=CC1C2 |
| InChI | InChI=1S/C16H19F3O2/c17-16(18,19)15(8-10-2-4-12(15)6-10)14(20)21-13-7-9-1-3-11(13)5-9/h2,4,9-13H,1,3,5-8H2 |
| InChIKey | OPLZPOOBIOFSLB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The IUPAC name of 2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (CID 20826551) is 2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
What is the SMILES notation for 2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The canonical SMILES for 2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate is O=C(OC1CC2CCC1C2)C1(C(F)(F)F)CC2C=CC1C2.
What is the InChIKey of 2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The InChIKey is OPLZPOOBIOFSLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F3O2/c17-16(18,19)15(8-10-2-4-12(15)6-10)14(20)21-13-7-9-1-3-11(13)5-9/h2,4,9-13H,1,3,5-8H2.
What are the key properties of 2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate?
2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate has a molecular weight of 300.32 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]heptanyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate is sourced from PubChem (CID 20826551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).