C12H22O — CID 20826706
2,2,3,3,4,4,5-heptamethylpyran (PubChem CID 20826706) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 2,2,3,3,4,4,5-heptamethylpyran.
| Compound Name | 2,2,3,3,4,4,5-heptamethylpyran |
|---|---|
| PubChem CID | 20826706 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 2,2,3,3,4,4,5-heptamethylpyran |
| SMILES | CC1=COC(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C12H22O/c1-9-8-13-12(6,7)11(4,5)10(9,2)3/h8H,1-7H3 |
| InChIKey | VFBWVECQVUXXBO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |