C19H14ClN5 — CID 20826932
2-N-(3-chlorophenyl)-4-N-quinolin-3-ylpyrimidine-2,4-diamine (PubChem CID 20826932) has the molecular formula C19H14ClN5 and a molecular weight of 347.81 g/mol. Its IUPAC name is 2-N-(3-chlorophenyl)-4-N-quinolin-3-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-chlorophenyl)-4-N-quinolin-3-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 20826932 |
| Molecular Formula | C19H14ClN5 |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-N-(3-chlorophenyl)-4-N-quinolin-3-ylpyrimidine-2,4-diamine |
| SMILES | Clc1cccc(Nc2nccc(Nc3cnc4ccccc4c3)n2)c1 |
| InChI | InChI=1S/C19H14ClN5/c20-14-5-3-6-15(11-14)24-19-21-9-8-18(25-19)23-16-10-13-4-1-2-7-17(13)22-12-16/h1-12H,(H2,21,23,24,25) |
| InChIKey | AAHOZWNLWKBWNN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |