C28H29F3N6O2 — CID 20826955
2-N-[4-(3-piperidin-1-ylpropoxy)phenyl]-4-N-[6-(trifluoromethoxy)quinolin-3-yl]pyrimidine-2,4-diamine (PubChem CID 20826955) has the molecular formula C28H29F3N6O2 and a molecular weight of 538.57 g/mol. Its IUPAC name is 2-N-[4-(3-piperidin-1-ylpropoxy)phenyl]-4-N-[6-(trifluoromethoxy)quinolin-3-yl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(3-piperidin-1-ylpropoxy)phenyl]-4-N-[6-(trifluoromethoxy)quinolin-3-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 20826955 |
| Molecular Formula | C28H29F3N6O2 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | 2-N-[4-(3-piperidin-1-ylpropoxy)phenyl]-4-N-[6-(trifluoromethoxy)quinolin-3-yl]pyrimidine-2,4-diamine |
| SMILES | FC(F)(F)Oc1ccc2ncc(Nc3ccnc(Nc4ccc(OCCCN5CCCCC5)cc4)n3)cc2c1 |
| InChI | InChI=1S/C28H29F3N6O2/c29-28(30,31)39-24-9-10-25-20(18-24)17-22(19-33-25)34-26-11-12-32-27(36-26)35-21-5-7-23(8-6-21)38-16-4-15-37-13-2-1-3-14-37/h5-12,17-19H,1-4,13-16H2,(H2,32,34,35,36) |
| InChIKey | GGMYRIIWGBONNN-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|