C21H20N6O3 — CID 20826992
4-N-quinoxalin-6-yl-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 20826992) has the molecular formula C21H20N6O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is 4-N-quinoxalin-6-yl-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-quinoxalin-6-yl-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 20826992 |
| Molecular Formula | C21H20N6O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 4-N-quinoxalin-6-yl-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2nccc(Nc3ccc4nccnc4c3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H20N6O3/c1-28-17-11-14(12-18(29-2)20(17)30-3)26-21-24-7-6-19(27-21)25-13-4-5-15-16(10-13)23-9-8-22-15/h4-12H,1-3H3,(H2,24,25,26,27) |
| InChIKey | KUUPDPUKVLILKM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |