C22H15N5O — CID 2082741
N-(4-cyanophenyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 2082741) has the molecular formula C22H15N5O and a molecular weight of 365.40 g/mol. Its IUPAC name is N-(4-cyanophenyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(4-cyanophenyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 2082741 |
| Molecular Formula | C22H15N5O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-(4-cyanophenyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2nc(-c3ccccc3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H15N5O/c23-15-16-11-13-18(14-12-16)24-22(28)20-25-21(17-7-3-1-4-8-17)27(26-20)19-9-5-2-6-10-19/h1-14H,(H,24,28) |
| InChIKey | IOFDXBMFFSKTFP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |