About N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide
N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide (PubChem CID 20827664) has the molecular formula C20H18N2O4S
and a molecular weight of 382.44 g/mol. Its IUPAC name is N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide |
| PubChem CID | 20827664 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccccc2)c(C(=O)c2cccc[n+]2[O-])cc1C |
| InChI | InChI=1S/C20H18N2O4S/c1-14-12-17(20(23)19-10-6-7-11-22(19)24)18(13-15(14)2)21-27(25,26)16-8-4-3-5-9-16/h3-13,21H,1-2H3 |
| InChIKey | HUBYCJKSZPEMRD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide?
The IUPAC name of N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide (CID 20827664) is N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide.
What is the SMILES notation for N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide?
The canonical SMILES for N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide is Cc1cc(NS(=O)(=O)c2ccccc2)c(C(=O)c2cccc[n+]2[O-])cc1C.
What is the InChIKey of N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide?
The InChIKey is HUBYCJKSZPEMRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O4S/c1-14-12-17(20(23)19-10-6-7-11-22(19)24)18(13-15(14)2)21-27(25,26)16-8-4-3-5-9-16/h3-13,21H,1-2H3.
What are the key properties of N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide?
N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide has a molecular weight of 382.44 g/mol, XLogP of 2.97, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4,5-dimethyl-2-(1-oxidopyridin-1-ium-2-carbonyl)phenyl]benzenesulfonamide is sourced from PubChem (CID 20827664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).