C22H22N2O4S — CID 20827672
N-[4,5-dimethyl-2-(3-methyl-1-oxidopyridin-1-ium-4-carbonyl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 20827672) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-[4,5-dimethyl-2-(3-methyl-1-oxidopyridin-1-ium-4-carbonyl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4,5-dimethyl-2-(3-methyl-1-oxidopyridin-1-ium-4-carbonyl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 20827672 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[4,5-dimethyl-2-(3-methyl-1-oxidopyridin-1-ium-4-carbonyl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C)c(C)cc2C(=O)c2cc[n+]([O-])cc2C)cc1 |
| InChI | InChI=1S/C22H22N2O4S/c1-14-5-7-18(8-6-14)29(27,28)23-21-12-16(3)15(2)11-20(21)22(25)19-9-10-24(26)13-17(19)4/h5-13,23H,1-4H3 |
| InChIKey | ADUOMXWSLDTAQX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|