About ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate
ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate (PubChem CID 20827744) has the molecular formula C10H14ClNO2
and a molecular weight of 215.68 g/mol. Its IUPAC name is ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate |
| PubChem CID | 20827744 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate |
| SMILES | CCOC(=O)NCC1C=CC(Cl)=CC1 |
| InChI | InChI=1S/C10H14ClNO2/c1-2-14-10(13)12-7-8-3-5-9(11)6-4-8/h3,5-6,8H,2,4,7H2,1H3,(H,12,13) |
| InChIKey | JAUMODPMMCRDHD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate?
The IUPAC name of ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate (CID 20827744) is ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate.
What is the SMILES notation for ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate?
The canonical SMILES for ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate is CCOC(=O)NCC1C=CC(Cl)=CC1.
What is the InChIKey of ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate?
The InChIKey is JAUMODPMMCRDHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClNO2/c1-2-14-10(13)12-7-8-3-5-9(11)6-4-8/h3,5-6,8H,2,4,7H2,1H3,(H,12,13).
What are the key properties of ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate?
ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate has a molecular weight of 215.68 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(4-chlorocyclohexa-2,4-dien-1-yl)methyl]carbamate is sourced from PubChem (CID 20827744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).