About 8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol
8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol (PubChem CID 20827864) has the molecular formula C13H16INO3
and a molecular weight of 361.18 g/mol. Its IUPAC name is 8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol.
Molecular Properties
| Compound Name | 8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol |
| PubChem CID | 20827864 |
| Molecular Formula | C13H16INO3 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol |
| SMILES | OC1(c2ccncc2I)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C13H16INO3/c14-11-9-15-6-1-10(11)12(16)2-4-13(5-3-12)17-7-8-18-13/h1,6,9,16H,2-5,7-8H2 |
| InChIKey | ZFMJSKWBBUACEA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol?
The IUPAC name of 8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol (CID 20827864) is 8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol.
What is the SMILES notation for 8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol?
The canonical SMILES for 8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol is OC1(c2ccncc2I)CCC2(CC1)OCCO2.
What is the InChIKey of 8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol?
The InChIKey is ZFMJSKWBBUACEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16INO3/c14-11-9-15-6-1-10(11)12(16)2-4-13(5-3-12)17-7-8-18-13/h1,6,9,16H,2-5,7-8H2.
What are the key properties of 8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol?
8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol has a molecular weight of 361.18 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-iodo-4-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol is sourced from PubChem (CID 20827864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).