C16H22N4O4 — CID 20828096
2-amino-3-ethenoxy-N-[2-(2-ethenoxyethylcarbamoylamino)phenyl]propanamide (PubChem CID 20828096) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-amino-3-ethenoxy-N-[2-(2-ethenoxyethylcarbamoylamino)phenyl]propanamide.
| Compound Name | 2-amino-3-ethenoxy-N-[2-(2-ethenoxyethylcarbamoylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 20828096 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-amino-3-ethenoxy-N-[2-(2-ethenoxyethylcarbamoylamino)phenyl]propanamide |
| SMILES | C=COCCNC(=O)Nc1ccccc1NC(=O)C(N)COC=C |
| InChI | InChI=1S/C16H22N4O4/c1-3-23-10-9-18-16(22)20-14-8-6-5-7-13(14)19-15(21)12(17)11-24-4-2/h3-8,12H,1-2,9-11,17H2,(H,19,21)(H2,18,20,22) |
| InChIKey | MCLNJJSFMAPCRI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|