About tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate
tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate (PubChem CID 20828399) has the molecular formula C27H34F2N2O3
and a molecular weight of 472.58 g/mol. Its IUPAC name is tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate |
| PubChem CID | 20828399 |
| Molecular Formula | C27H34F2N2O3 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)CCCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H34F2N2O3/c1-27(2,3)34-26(33)31-18-16-30(17-19-31)25(32)7-5-4-6-24(20-8-12-22(28)13-9-20)21-10-14-23(29)15-11-21/h8-15,24H,4-7,16-19H2,1-3H3 |
| InChIKey | JPUIYTJDHCISHS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate (CID 20828399) is tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCN(C(=O)CCCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1.
What is the InChIKey of tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate?
The InChIKey is JPUIYTJDHCISHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H34F2N2O3/c1-27(2,3)34-26(33)31-18-16-30(17-19-31)25(32)7-5-4-6-24(20-8-12-22(28)13-9-20)21-10-14-23(29)15-11-21/h8-15,24H,4-7,16-19H2,1-3H3.
What are the key properties of tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate?
tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate has a molecular weight of 472.58 g/mol, XLogP of 5.74, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[6,6-bis(4-fluorophenyl)hexanoyl]piperazine-1-carboxylate is sourced from PubChem (CID 20828399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).