About (3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate
(3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate (PubChem CID 20828582) has the molecular formula C13H15Cl2NO4S
and a molecular weight of 352.24 g/mol. Its IUPAC name is (3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | (3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate |
| PubChem CID | 20828582 |
| Molecular Formula | C13H15Cl2NO4S |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | (3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate |
| SMILES | CC1(C)CCN[C@@H]1C(=O)OS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO4S/c1-13(2)3-4-16-11(13)12(17)20-21(18,19)10-6-8(14)5-9(15)7-10/h5-7,11,16H,3-4H2,1-2H3/t11-/m1/s1 |
| InChIKey | MOCXBLPXSSETSL-LLVKDONJSA-N |
| XLogP | 2.61 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate?
The IUPAC name of (3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate (CID 20828582) is (3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate.
What is the SMILES notation for (3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate?
The canonical SMILES for (3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate is CC1(C)CCN[C@@H]1C(=O)OS(=O)(=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of (3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate?
The InChIKey is MOCXBLPXSSETSL-LLVKDONJSA-N. The full InChI is InChI=1S/C13H15Cl2NO4S/c1-13(2)3-4-16-11(13)12(17)20-21(18,19)10-6-8(14)5-9(15)7-10/h5-7,11,16H,3-4H2,1-2H3/t11-/m1/s1.
What are the key properties of (3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate?
(3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate has a molecular weight of 352.24 g/mol, XLogP of 2.61, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dichlorophenyl)sulfonyl (2S)-3,3-dimethylpyrrolidine-2-carboxylate is sourced from PubChem (CID 20828582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).