About methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate
methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate (PubChem CID 20828590) has the molecular formula C19H19Cl2NO4S
and a molecular weight of 428.34 g/mol. Its IUPAC name is methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate |
| PubChem CID | 20828590 |
| Molecular Formula | C19H19Cl2NO4S |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1(C)[C@H](c2ccccc2)CCN1S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H19Cl2NO4S/c1-19(18(23)26-2)17(13-6-4-3-5-7-13)8-9-22(19)27(24,25)16-11-14(20)10-15(21)12-16/h3-7,10-12,17H,8-9H2,1-2H3/t17-,19?/m0/s1 |
| InChIKey | YBMXVECHNBUITP-KKFHFHRHSA-N |
| XLogP | 4.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate?
The IUPAC name of methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate (CID 20828590) is methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate.
What is the SMILES notation for methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate?
The canonical SMILES for methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate is COC(=O)C1(C)[C@H](c2ccccc2)CCN1S(=O)(=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate?
The InChIKey is YBMXVECHNBUITP-KKFHFHRHSA-N. The full InChI is InChI=1S/C19H19Cl2NO4S/c1-19(18(23)26-2)17(13-6-4-3-5-7-13)8-9-22(19)27(24,25)16-11-14(20)10-15(21)12-16/h3-7,10-12,17H,8-9H2,1-2H3/t17-,19?/m0/s1.
What are the key properties of methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate?
methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate has a molecular weight of 428.34 g/mol, XLogP of 4.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-1-(3,5-dichlorophenyl)sulfonyl-2-methyl-3-phenylpyrrolidine-2-carboxylate is sourced from PubChem (CID 20828590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).