C20H21NO4 — CID 20828930
methyl 4-[(2-hydroxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methyl-methylamino]benzoate (PubChem CID 20828930) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is methyl 4-[(2-hydroxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methyl-methylamino]benzoate.
| Compound Name | methyl 4-[(2-hydroxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methyl-methylamino]benzoate |
|---|---|
| PubChem CID | 20828930 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | methyl 4-[(2-hydroxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methyl-methylamino]benzoate |
| SMILES | COC(=O)c1ccc(N(C)Cc2c(O)ccc3c2CCCC3=O)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-21(14-8-6-13(7-9-14)20(24)25-2)12-17-15-4-3-5-18(22)16(15)10-11-19(17)23/h6-11,23H,3-5,12H2,1-2H3 |
| InChIKey | CKEVBXYSDIBXGW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|