C15H27N3 — CID 20829080
3,5,6-tritert-butyl-1,2,4-triazine (PubChem CID 20829080) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 3,5,6-tritert-butyl-1,2,4-triazine.
| Compound Name | 3,5,6-tritert-butyl-1,2,4-triazine |
|---|---|
| PubChem CID | 20829080 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 3,5,6-tritert-butyl-1,2,4-triazine |
| SMILES | CC(C)(C)c1nnc(C(C)(C)C)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C15H27N3/c1-13(2,3)10-11(14(4,5)6)17-18-12(16-10)15(7,8)9/h1-9H3 |
| InChIKey | IFUHOFVUDJXLSB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |