C14H8F12O2 — CID 20829137
2-[3-ethenyl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 20829137) has the molecular formula C14H8F12O2 and a molecular weight of 436.19 g/mol. Its IUPAC name is 2-[3-ethenyl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-ethenyl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 20829137 |
| Molecular Formula | C14H8F12O2 |
| Molecular Weight | 436.19 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 2-[3-ethenyl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | C=Cc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(C(O)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H8F12O2/c1-2-6-3-7(9(27,11(15,16)17)12(18,19)20)5-8(4-6)10(28,13(21,22)23)14(24,25)26/h2-5,27-28H,1H2 |
| InChIKey | BALPBFINLSLTCP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.19 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |