C18H26O7 — CID 20829665
tert-butyl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 20829665) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is tert-butyl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | tert-butyl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 20829665 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | tert-butyl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1C2OC(=O)C3C2OC1C3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26O7/c1-7-18(5,6)16(21)24-13-11-9(15(20)25-17(2,3)4)8-10(22-11)12(13)23-14(8)19/h8-13H,7H2,1-6H3 |
| InChIKey | NAZFGZSPOGHFNW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|