About tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate
tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate (PubChem CID 20829973) has the molecular formula C23H28F2N4O3
and a molecular weight of 446.50 g/mol. Its IUPAC name is tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate |
| PubChem CID | 20829973 |
| Molecular Formula | C23H28F2N4O3 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate |
| SMILES | CN(C(=O)Nc1ccc(-c2cc(F)ccc2F)cn1)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H28F2N4O3/c1-23(2,3)32-22(31)29-11-9-17(10-12-29)28(4)21(30)27-20-8-5-15(14-26-20)18-13-16(24)6-7-19(18)25/h5-8,13-14,17H,9-12H2,1-4H3,(H,26,27,30) |
| InChIKey | JXRBKXCTTWOVDB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate (CID 20829973) is tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate is CN(C(=O)Nc1ccc(-c2cc(F)ccc2F)cn1)C1CCN(C(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate?
The InChIKey is JXRBKXCTTWOVDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28F2N4O3/c1-23(2,3)32-22(31)29-11-9-17(10-12-29)28(4)21(30)27-20-8-5-15(14-26-20)18-13-16(24)6-7-19(18)25/h5-8,13-14,17H,9-12H2,1-4H3,(H,26,27,30).
What are the key properties of tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate?
tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate has a molecular weight of 446.50 g/mol, XLogP of 4.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[[5-(2,5-difluorophenyl)-2-pyridinyl]carbamoyl-methylamino]piperidine-1-carboxylate is sourced from PubChem (CID 20829973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).