About (5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one
(5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one (PubChem CID 20830000) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is (5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | (5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one |
| PubChem CID | 20830000 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one |
| SMILES | O=C1CC[C@@H](C(=O)C2NCCS2)N1 |
| InChI | InChI=1S/C8H12N2O2S/c11-6-2-1-5(10-6)7(12)8-9-3-4-13-8/h5,8-9H,1-4H2,(H,10,11)/t5-,8?/m0/s1 |
| InChIKey | XPGDWCLHVJTZKG-NTFOPCPOSA-N |
| XLogP | -0.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one?
The IUPAC name of (5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one (CID 20830000) is (5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one.
What is the SMILES notation for (5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one?
The canonical SMILES for (5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one is O=C1CC[C@@H](C(=O)C2NCCS2)N1.
What is the InChIKey of (5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one?
The InChIKey is XPGDWCLHVJTZKG-NTFOPCPOSA-N. The full InChI is InChI=1S/C8H12N2O2S/c11-6-2-1-5(10-6)7(12)8-9-3-4-13-8/h5,8-9H,1-4H2,(H,10,11)/t5-,8?/m0/s1.
What are the key properties of (5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one?
(5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one has a molecular weight of 200.26 g/mol, XLogP of -0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(1,3-thiazolidine-2-carbonyl)pyrrolidin-2-one is sourced from PubChem (CID 20830000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).