About 4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide
4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide (PubChem CID 2083068) has the molecular formula C11H9ClN2OS
and a molecular weight of 252.73 g/mol. Its IUPAC name is 4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide |
| PubChem CID | 2083068 |
| Molecular Formula | C11H9ClN2OS |
| Molecular Weight | 252.73 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide |
| SMILES | Cn1ccs/c1=N/C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H9ClN2OS/c1-14-6-7-16-11(14)13-10(15)8-2-4-9(12)5-3-8/h2-7H,1H3/b13-11+ |
| InChIKey | CSEUTQNKXLGGLY-ACCUITESSA-N |
| XLogP | 2.48 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.73 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide?
The IUPAC name of 4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide (CID 2083068) is 4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide.
What is the SMILES notation for 4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide?
The canonical SMILES for 4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide is Cn1ccs/c1=N/C(=O)c1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide?
The InChIKey is CSEUTQNKXLGGLY-ACCUITESSA-N. The full InChI is InChI=1S/C11H9ClN2OS/c1-14-6-7-16-11(14)13-10(15)8-2-4-9(12)5-3-8/h2-7H,1H3/b13-11+.
What are the key properties of 4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide?
4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide has a molecular weight of 252.73 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide is sourced from PubChem (CID 2083068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).