C21H17N3O2S2 — CID 2083119
N-benzhydryl-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide (PubChem CID 2083119) has the molecular formula C21H17N3O2S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-benzhydryl-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-benzhydryl-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2083119 |
| Molecular Formula | C21H17N3O2S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-benzhydryl-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2cccs2)o1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17N3O2S2/c25-18(14-28-21-24-23-20(26-21)17-12-7-13-27-17)22-19(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-13,19H,14H2,(H,22,25) |
| InChIKey | OEQDNTRGVNEHBN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |