C16H25O7-3 — CID 20831637
(2S,3S)-2-hydroxytridecane-1,2,3-tricarboxylate (PubChem CID 20831637) has the molecular formula C16H25O7-3 and a molecular weight of 329.37 g/mol. Its IUPAC name is (2S,3S)-2-hydroxytridecane-1,2,3-tricarboxylate.
| Compound Name | (2S,3S)-2-hydroxytridecane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 20831637 |
| Molecular Formula | C16H25O7-3 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (2S,3S)-2-hydroxytridecane-1,2,3-tricarboxylate |
| SMILES | CCCCCCCCCC[C@H](C(=O)[O-])[C@@](O)(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C16H28O7/c1-2-3-4-5-6-7-8-9-10-12(14(19)20)16(23,15(21)22)11-13(17)18/h12,23H,2-11H2,1H3,(H,17,18)(H,19,20)(H,21,22)/p-3/t12-,16+/m1/s1 |
| InChIKey | DQIHPEKINXOMBM-WBMJQRKESA-K |
| XLogP | -1.50 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|