C17H27O7-3 — CID 20831685
(3S,4S)-3-hydroxytetradecane-1,3,4-tricarboxylate (PubChem CID 20831685) has the molecular formula C17H27O7-3 and a molecular weight of 343.40 g/mol. Its IUPAC name is (3S,4S)-3-hydroxytetradecane-1,3,4-tricarboxylate.
| Compound Name | (3S,4S)-3-hydroxytetradecane-1,3,4-tricarboxylate |
|---|---|
| PubChem CID | 20831685 |
| Molecular Formula | C17H27O7-3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (3S,4S)-3-hydroxytetradecane-1,3,4-tricarboxylate |
| SMILES | CCCCCCCCCC[C@H](C(=O)[O-])[C@@](O)(CCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C17H30O7/c1-2-3-4-5-6-7-8-9-10-13(15(20)21)17(24,16(22)23)12-11-14(18)19/h13,24H,2-12H2,1H3,(H,18,19)(H,20,21)(H,22,23)/p-3/t13-,17+/m1/s1 |
| InChIKey | QFOFNCNFUGQWTO-DYVFJYSZSA-K |
| XLogP | -1.11 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|