About 6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid
6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid (PubChem CID 20832148) has the molecular formula C12H9ClO5
and a molecular weight of 268.65 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid.
Molecular Properties
| Compound Name | 6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid |
| PubChem CID | 20832148 |
| Molecular Formula | C12H9ClO5 |
| Molecular Weight | 268.65 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid |
| SMILES | O=C(CC(=O)C(=O)O)CC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C12H9ClO5/c13-9-4-2-1-3-8(9)10(15)5-7(14)6-11(16)12(17)18/h1-4H,5-6H2,(H,17,18) |
| InChIKey | XKIINEUWADSLBK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.65 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid?
The IUPAC name of 6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid (CID 20832148) is 6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid.
What is the SMILES notation for 6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid?
The canonical SMILES for 6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid is O=C(CC(=O)C(=O)O)CC(=O)c1ccccc1Cl.
What is the InChIKey of 6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid?
The InChIKey is XKIINEUWADSLBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClO5/c13-9-4-2-1-3-8(9)10(15)5-7(14)6-11(16)12(17)18/h1-4H,5-6H2,(H,17,18).
What are the key properties of 6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid?
6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid has a molecular weight of 268.65 g/mol, XLogP of 1.53, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-chlorophenyl)-2,4,6-trioxohexanoic acid is sourced from PubChem (CID 20832148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).