About (E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione
(E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione (PubChem CID 20832422) has the molecular formula C17H20N2O6
and a molecular weight of 348.36 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione |
| PubChem CID | 20832422 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione |
| SMILES | CCCCC1C(=O)NN(c2ccccc2)C1=O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H16N2O2.C4H4O4/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10;5-3(6)1-2-4(7)8/h4-8,11H,2-3,9H2,1H3,(H,14,16);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HHOUNNLRJXCQFN-WLHGVMLRSA-N |
| XLogP | 1.58 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione?
The IUPAC name of (E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione (CID 20832422) is (E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione.
What is the SMILES notation for (E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione?
The canonical SMILES for (E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione is CCCCC1C(=O)NN(c2ccccc2)C1=O.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione?
The InChIKey is HHOUNNLRJXCQFN-WLHGVMLRSA-N. The full InChI is InChI=1S/C13H16N2O2.C4H4O4/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10;5-3(6)1-2-4(7)8/h4-8,11H,2-3,9H2,1H3,(H,14,16);1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione?
(E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione has a molecular weight of 348.36 g/mol, XLogP of 1.58, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;4-butyl-1-phenylpyrazolidine-3,5-dione is sourced from PubChem (CID 20832422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).