C20H15Cl2FNO4S- — CID 20832477
3-chloro-4-[(1E,3E,5E,7E)-8-[2-chloro-4-[hydroxy(oxido)amino]phenyl]octa-1,3,5,7-tetraenyl]benzenesulfonyl fluoride (PubChem CID 20832477) has the molecular formula C20H15Cl2FNO4S- and a molecular weight of 455.31 g/mol. Its IUPAC name is 3-chloro-4-[(1E,3E,5E,7E)-8-[2-chloro-4-[hydroxy(oxido)amino]phenyl]octa-1,3,5,7-tetraenyl]benzenesulfonyl fluoride.
| Compound Name | 3-chloro-4-[(1E,3E,5E,7E)-8-[2-chloro-4-[hydroxy(oxido)amino]phenyl]octa-1,3,5,7-tetraenyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 20832477 |
| Molecular Formula | C20H15Cl2FNO4S- |
| Molecular Weight | 455.31 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | 3-chloro-4-[(1E,3E,5E,7E)-8-[2-chloro-4-[hydroxy(oxido)amino]phenyl]octa-1,3,5,7-tetraenyl]benzenesulfonyl fluoride |
| SMILES | O=S(=O)(F)c1ccc(/C=C/C=C/C=C/C=C/c2ccc(N([O-])O)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H15Cl2FNO4S/c21-19-13-17(24(25)26)11-9-15(19)7-5-3-1-2-4-6-8-16-10-12-18(14-20(16)22)29(23,27)28/h1-14,25H/q-1/b3-1+,4-2+,7-5+,8-6+ |
| InChIKey | IXVUFIOUGJWLLI-QEQQUMNJSA-N |
| XLogP | 6.18 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.31 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|