C42H59N5O4 — CID 20832693
N-[(1S,2S)-2-[[2-benzyl-5-[[(2S)-3-(tert-butylamino)-2-(cyclohexylmethyl)-3-oxopropyl]amino]-4-hydroxypentanoyl]amino]cyclohexyl]quinoline-2-carboxamide (PubChem CID 20832693) has the molecular formula C42H59N5O4 and a molecular weight of 697.97 g/mol. Its IUPAC name is N-[(1S,2S)-2-[[2-benzyl-5-[[(2S)-3-(tert-butylamino)-2-(cyclohexylmethyl)-3-oxopropyl]amino]-4-hydroxypentanoyl]amino]cyclohexyl]quinoline-2-carboxamide.
| Compound Name | N-[(1S,2S)-2-[[2-benzyl-5-[[(2S)-3-(tert-butylamino)-2-(cyclohexylmethyl)-3-oxopropyl]amino]-4-hydroxypentanoyl]amino]cyclohexyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 20832693 |
| Molecular Formula | C42H59N5O4 |
| Molecular Weight | 697.97 g/mol |
| Exact Mass | 697.46 |
| IUPAC Name | N-[(1S,2S)-2-[[2-benzyl-5-[[(2S)-3-(tert-butylamino)-2-(cyclohexylmethyl)-3-oxopropyl]amino]-4-hydroxypentanoyl]amino]cyclohexyl]quinoline-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@H](CNCC(O)CC(Cc1ccccc1)C(=O)N[C@H]1CCCC[C@@H]1NC(=O)c1ccc2ccccc2n1)CC1CCCCC1 |
| InChI | InChI=1S/C42H59N5O4/c1-42(2,3)47-40(50)33(25-30-16-8-5-9-17-30)27-43-28-34(48)26-32(24-29-14-6-4-7-15-29)39(49)45-36-20-12-13-21-37(36)46-41(51)38-23-22-31-18-10-11-19-35(31)44-38/h4,6-7,10-11,14-15,18-19,22-23,30,32-34,36-37,43,48H,5,8-9,12-13,16-17,20-21,24-28H2,1-3H3,(H,45,49)(H,46,51)(H,47,50)/t32?,33-,34?,36-,37-/m0/s1 |
| InChIKey | ANAAJTJKNJHCRR-ZHBJZAGOSA-N |
| XLogP | 6.09 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.97 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |